C17H19Cl2N3O2 — CID 4809052
2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-(4-methylcyclohexyl)acetamide (PubChem CID 4809052) has the molecular formula C17H19Cl2N3O2 and a molecular weight of 368.26 g/mol. Its IUPAC name is 2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-(4-methylcyclohexyl)acetamide.
| Compound Name | 2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-(4-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 4809052 |
| Molecular Formula | C17H19Cl2N3O2 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-(4-methylcyclohexyl)acetamide |
| SMILES | CC1CCC(NC(=O)Cn2cnc3c(Cl)cc(Cl)cc3c2=O)CC1 |
| InChI | InChI=1S/C17H19Cl2N3O2/c1-10-2-4-12(5-3-10)21-15(23)8-22-9-20-16-13(17(22)24)6-11(18)7-14(16)19/h6-7,9-10,12H,2-5,8H2,1H3,(H,21,23) |
| InChIKey | HAVVZDBSVLTHJE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |