C16H18Cl2N4O4 — CID 7875350
2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-(3-ethoxypropylcarbamoyl)acetamide (PubChem CID 7875350) has the molecular formula C16H18Cl2N4O4 and a molecular weight of 401.25 g/mol. Its IUPAC name is 2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-(3-ethoxypropylcarbamoyl)acetamide.
| Compound Name | 2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-(3-ethoxypropylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 7875350 |
| Molecular Formula | C16H18Cl2N4O4 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-(3-ethoxypropylcarbamoyl)acetamide |
| SMILES | CCOCCCNC(=O)NC(=O)Cn1cnc2c(Cl)cc(Cl)cc2c1=O |
| InChI | InChI=1S/C16H18Cl2N4O4/c1-2-26-5-3-4-19-16(25)21-13(23)8-22-9-20-14-11(15(22)24)6-10(17)7-12(14)18/h6-7,9H,2-5,8H2,1H3,(H2,19,21,23,25) |
| InChIKey | YQIQABRRZAPVGU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|