C20H20Cl2N4O4S — CID 46817824
2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-[3-(diethylsulfamoyl)phenyl]acetamide (PubChem CID 46817824) has the molecular formula C20H20Cl2N4O4S and a molecular weight of 483.38 g/mol. Its IUPAC name is 2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-[3-(diethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-[3-(diethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 46817824 |
| Molecular Formula | C20H20Cl2N4O4S |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-[3-(diethylsulfamoyl)phenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NC(=O)Cn2cnc3c(Cl)cc(Cl)cc3c2=O)c1 |
| InChI | InChI=1S/C20H20Cl2N4O4S/c1-3-26(4-2)31(29,30)15-7-5-6-14(10-15)24-18(27)11-25-12-23-19-16(20(25)28)8-13(21)9-17(19)22/h5-10,12H,3-4,11H2,1-2H3,(H,24,27) |
| InChIKey | KBXVYLVWSXGBBS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |