C17H12Cl2N4O4 — CID 30759718
2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-(4-methyl-3-nitrophenyl)acetamide (PubChem CID 30759718) has the molecular formula C17H12Cl2N4O4 and a molecular weight of 407.21 g/mol. Its IUPAC name is 2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-(4-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-(4-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 30759718 |
| Molecular Formula | C17H12Cl2N4O4 |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 2-(6,8-dichloro-4-oxoquinazolin-3-yl)-N-(4-methyl-3-nitrophenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2cnc3c(Cl)cc(Cl)cc3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12Cl2N4O4/c1-9-2-3-11(6-14(9)23(26)27)21-15(24)7-22-8-20-16-12(17(22)25)4-10(18)5-13(16)19/h2-6,8H,7H2,1H3,(H,21,24) |
| InChIKey | YVCPGEYSQVPHRN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|