C17H14ClN3O4S — CID 9355991
2-(6-chloro-4-oxoquinazolin-3-yl)-N-(3-methylsulfonylphenyl)acetamide (PubChem CID 9355991) has the molecular formula C17H14ClN3O4S and a molecular weight of 391.84 g/mol. Its IUPAC name is 2-(6-chloro-4-oxoquinazolin-3-yl)-N-(3-methylsulfonylphenyl)acetamide.
| Compound Name | 2-(6-chloro-4-oxoquinazolin-3-yl)-N-(3-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 9355991 |
| Molecular Formula | C17H14ClN3O4S |
| Molecular Weight | 391.84 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 2-(6-chloro-4-oxoquinazolin-3-yl)-N-(3-methylsulfonylphenyl)acetamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)Cn2cnc3ccc(Cl)cc3c2=O)c1 |
| InChI | InChI=1S/C17H14ClN3O4S/c1-26(24,25)13-4-2-3-12(8-13)20-16(22)9-21-10-19-15-6-5-11(18)7-14(15)17(21)23/h2-8,10H,9H2,1H3,(H,20,22) |
| InChIKey | VCJZRSGHRLPUBY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.84 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |