C24H27N3O3 — CID 4810168
2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)-N-(4-phenylbutan-2-yl)acetamide (PubChem CID 4810168) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)-N-(4-phenylbutan-2-yl)acetamide.
| Compound Name | 2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)-N-(4-phenylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 4810168 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-(2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl)-N-(4-phenylbutan-2-yl)acetamide |
| SMILES | CC(CCc1ccccc1)NC(=O)CN1C(=O)NC2(CCCc3ccccc32)C1=O |
| InChI | InChI=1S/C24H27N3O3/c1-17(13-14-18-8-3-2-4-9-18)25-21(28)16-27-22(29)24(26-23(27)30)15-7-11-19-10-5-6-12-20(19)24/h2-6,8-10,12,17H,7,11,13-16H2,1H3,(H,25,28)(H,26,30) |
| InChIKey | IHODMMHKLWFQGC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|