C22H22N4O4 — CID 27227787
N'-[2-[(4S)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]acetyl]-2-phenylacetohydrazide (PubChem CID 27227787) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is N'-[2-[(4S)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]acetyl]-2-phenylacetohydrazide.
| Compound Name | N'-[2-[(4S)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]acetyl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 27227787 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N'-[2-[(4S)-2',5'-dioxospiro[2,3-dihydro-1H-naphthalene-4,4'-imidazolidine]-1'-yl]acetyl]-2-phenylacetohydrazide |
| SMILES | O=C(Cc1ccccc1)NNC(=O)CN1C(=O)N[C@]2(CCCc3ccccc32)C1=O |
| InChI | InChI=1S/C22H22N4O4/c27-18(13-15-7-2-1-3-8-15)24-25-19(28)14-26-20(29)22(23-21(26)30)12-6-10-16-9-4-5-11-17(16)22/h1-5,7-9,11H,6,10,12-14H2,(H,23,30)(H,24,27)(H,25,28)/t22-/m0/s1 |
| InChIKey | GEKAQJFJPNBNDN-QFIPXVFZSA-N |
| XLogP | 1.16 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|