C19H18ClN3O3S — CID 4815298
2-[3-(4-chloro-2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide (PubChem CID 4815298) has the molecular formula C19H18ClN3O3S and a molecular weight of 403.89 g/mol. Its IUPAC name is 2-[3-(4-chloro-2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide.
| Compound Name | 2-[3-(4-chloro-2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 4815298 |
| Molecular Formula | C19H18ClN3O3S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-[3-(4-chloro-2-methoxy-5-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
| SMILES | COc1cc(Cl)c(C)cc1-n1c(SC(C)C(N)=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C19H18ClN3O3S/c1-10-8-15(16(26-3)9-13(10)20)23-18(25)12-6-4-5-7-14(12)22-19(23)27-11(2)17(21)24/h4-9,11H,1-3H3,(H2,21,24) |
| InChIKey | UWFYYMUAWIZGBE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |