C19H19N3O2S — CID 7419008
(2R)-2-[3-(2,3-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide (PubChem CID 7419008) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is (2R)-2-[3-(2,3-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide.
| Compound Name | (2R)-2-[3-(2,3-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7419008 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2R)-2-[3-(2,3-dimethylphenyl)-4-oxoquinazolin-2-yl]sulfanylpropanamide |
| SMILES | Cc1cccc(-n2c(S[C@H](C)C(N)=O)nc3ccccc3c2=O)c1C |
| InChI | InChI=1S/C19H19N3O2S/c1-11-7-6-10-16(12(11)2)22-18(24)14-8-4-5-9-15(14)21-19(22)25-13(3)17(20)23/h4-10,13H,1-3H3,(H2,20,23)/t13-/m1/s1 |
| InChIKey | CQHICVQYVSTXSG-CYBMUJFWSA-N |
| XLogP | 2.97 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |