C19H18O5 — CID 4816242
(2,6-dimethoxyphenyl) 2-(6-methyl-1-benzofuran-3-yl)acetate (PubChem CID 4816242) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl) 2-(6-methyl-1-benzofuran-3-yl)acetate.
| Compound Name | (2,6-dimethoxyphenyl) 2-(6-methyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 4816242 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (2,6-dimethoxyphenyl) 2-(6-methyl-1-benzofuran-3-yl)acetate |
| SMILES | COc1cccc(OC)c1OC(=O)Cc1coc2cc(C)ccc12 |
| InChI | InChI=1S/C19H18O5/c1-12-7-8-14-13(11-23-17(14)9-12)10-18(20)24-19-15(21-2)5-4-6-16(19)22-3/h4-9,11H,10H2,1-3H3 |
| InChIKey | FAFKZGMKJQUPFJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|