C16H17NO6 — CID 8737539
[(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 2-(6-methyl-1-benzofuran-3-yl)acetate (PubChem CID 8737539) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is [(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 2-(6-methyl-1-benzofuran-3-yl)acetate.
| Compound Name | [(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 2-(6-methyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 8737539 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl] 2-(6-methyl-1-benzofuran-3-yl)acetate |
| SMILES | COC(=O)NC(=O)[C@H](C)OC(=O)Cc1coc2cc(C)ccc12 |
| InChI | InChI=1S/C16H17NO6/c1-9-4-5-12-11(8-22-13(12)6-9)7-14(18)23-10(2)15(19)17-16(20)21-3/h4-6,8,10H,7H2,1-3H3,(H,17,19,20)/t10-/m0/s1 |
| InChIKey | YRGJBNUHHRCRMJ-JTQLQIEISA-N |
| XLogP | 2.10 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |