C15H16N2O5 — CID 7872173
[(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(6-methyl-1-benzofuran-3-yl)acetate (PubChem CID 7872173) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(6-methyl-1-benzofuran-3-yl)acetate.
| Compound Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(6-methyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7872173 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(6-methyl-1-benzofuran-3-yl)acetate |
| SMILES | Cc1ccc2c(CC(=O)O[C@@H](C)C(=O)NC(N)=O)coc2c1 |
| InChI | InChI=1S/C15H16N2O5/c1-8-3-4-11-10(7-21-12(11)5-8)6-13(18)22-9(2)14(19)17-15(16)20/h3-5,7,9H,6H2,1-2H3,(H3,16,17,19,20)/t9-/m0/s1 |
| InChIKey | OJDLCYFSTAUVTM-VIFPVBQESA-N |
| XLogP | 1.41 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |