C16H18N2O6 — CID 7902035
[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-(6-methoxy-1-benzofuran-3-yl)acetate (PubChem CID 7902035) has the molecular formula C16H18N2O6 and a molecular weight of 334.33 g/mol. Its IUPAC name is [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-(6-methoxy-1-benzofuran-3-yl)acetate.
| Compound Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-(6-methoxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7902035 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 2-(6-methoxy-1-benzofuran-3-yl)acetate |
| SMILES | CNC(=O)NC(=O)[C@@H](C)OC(=O)Cc1coc2cc(OC)ccc12 |
| InChI | InChI=1S/C16H18N2O6/c1-9(15(20)18-16(21)17-2)24-14(19)6-10-8-23-13-7-11(22-3)4-5-12(10)13/h4-5,7-9H,6H2,1-3H3,(H2,17,18,20,21)/t9-/m1/s1 |
| InChIKey | LHWYJCDUEMTKSG-SECBINFHSA-N |
| XLogP | 1.37 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |