C16H14FN5O4S — CID 4817534
N-(2-fluoro-5-nitrophenyl)-2-[[4-methyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4817534) has the molecular formula C16H14FN5O4S and a molecular weight of 391.38 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-2-[[4-methyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-2-[[4-methyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4817534 |
| Molecular Formula | C16H14FN5O4S |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-2-[[4-methyl-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1occc1-c1nnc(SCC(=O)Nc2cc([N+](=O)[O-])ccc2F)n1C |
| InChI | InChI=1S/C16H14FN5O4S/c1-9-11(5-6-26-9)15-19-20-16(21(15)2)27-8-14(23)18-13-7-10(22(24)25)3-4-12(13)17/h3-7H,8H2,1-2H3,(H,18,23) |
| InChIKey | SYCXQFXBWKSMJH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|