C19H27N3O4S2 — CID 48178
Ammonium, (2-(10H-pyrido(3,2-b)(1,4)benzothiazin-10-yl)propyl)trimethyl-, ethyl sulfate (PubChem CID 48178) has the molecular formula C19H27N3O4S2 and a molecular weight of 425.60 g/mol. Its IUPAC name is ethyl sulfate;trimethyl(2-pyrido[3,2-b][1,4]benzothiazin-10-ylpropyl)azanium.
| Compound Name | Ammonium, (2-(10H-pyrido(3,2-b)(1,4)benzothiazin-10-yl)propyl)trimethyl-, ethyl sulfate |
|---|---|
| PubChem CID | 48178 |
| Molecular Formula | C19H27N3O4S2 |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | ethyl sulfate;trimethyl(2-pyrido[3,2-b][1,4]benzothiazin-10-ylpropyl)azanium |
| SMILES | CCOS(=O)(=O)[O-].CC(C[N+](C)(C)C)N1C2=CC=CC=C2SC3=C1N=CC=C3 |
| InChI | InChI=1S/C17H22N3S.C2H6O4S/c1-13(12-20(2,3)4)19-14-8-5-6-9-15(14)21-16-10-7-11-18-17(16)19;1-2-6-7(3,4)5/h5-11,13H,12H2,1-4H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | NYZBJKVPWHHEOI-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 116.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | 458 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|