C17H13N3O2S2 — CID 4826571
2-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]isoindole-1,3-dione (PubChem CID 4826571) has the molecular formula C17H13N3O2S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]isoindole-1,3-dione.
| Compound Name | 2-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4826571 |
| Molecular Formula | C17H13N3O2S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-[(6-ethylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]isoindole-1,3-dione |
| SMILES | CCc1cc2c(SCN3C(=O)c4ccccc4C3=O)ncnc2s1 |
| InChI | InChI=1S/C17H13N3O2S2/c1-2-10-7-13-14(18-8-19-15(13)24-10)23-9-20-16(21)11-5-3-4-6-12(11)17(20)22/h3-8H,2,9H2,1H3 |
| InChIKey | LOZXEQOXJMQSQU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|