C16H18FN3O3S2 — CID 4827139
4-fluoro-N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 4827139) has the molecular formula C16H18FN3O3S2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-fluoro-N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-fluoro-N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 4827139 |
| Molecular Formula | C16H18FN3O3S2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 4-fluoro-N-(5-methyl-1,3-thiazol-2-yl)-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1cnc(NC(=O)c2ccc(F)c(S(=O)(=O)N3CCCCC3)c2)s1 |
| InChI | InChI=1S/C16H18FN3O3S2/c1-11-10-18-16(24-11)19-15(21)12-5-6-13(17)14(9-12)25(22,23)20-7-3-2-4-8-20/h5-6,9-10H,2-4,7-8H2,1H3,(H,18,19,21) |
| InChIKey | RURXVQIOTAYAPE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |