C14H9F3IN3O — CID 4829295
7-iodo-4-phenyl-4-(trifluoromethyl)-3H-pyrido[1,2-a][1,3,5]triazin-2-one (PubChem CID 4829295) has the molecular formula C14H9F3IN3O and a molecular weight of 419.14 g/mol. Its IUPAC name is 7-iodo-4-phenyl-4-(trifluoromethyl)-3H-pyrido[1,2-a][1,3,5]triazin-2-one.
| Compound Name | 7-iodo-4-phenyl-4-(trifluoromethyl)-3H-pyrido[1,2-a][1,3,5]triazin-2-one |
|---|---|
| PubChem CID | 4829295 |
| Molecular Formula | C14H9F3IN3O |
| Molecular Weight | 419.14 g/mol |
| Exact Mass | 418.97 |
| IUPAC Name | 7-iodo-4-phenyl-4-(trifluoromethyl)-3H-pyrido[1,2-a][1,3,5]triazin-2-one |
| SMILES | O=C1N=C2C=CC(I)=CN2C(c2ccccc2)(C(F)(F)F)N1 |
| InChI | InChI=1S/C14H9F3IN3O/c15-14(16,17)13(9-4-2-1-3-5-9)20-12(22)19-11-7-6-10(18)8-21(11)13/h1-8H,(H,20,22) |
| InChIKey | UKPPSJQWVKBDOZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|