C28H28N4O3S — CID 4830919
2-[[5-(2-methoxyphenyl)-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 4830919) has the molecular formula C28H28N4O3S and a molecular weight of 500.62 g/mol. Its IUPAC name is 2-[[5-(2-methoxyphenyl)-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-[[5-(2-methoxyphenyl)-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 4830919 |
| Molecular Formula | C28H28N4O3S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 2-[[5-(2-methoxyphenyl)-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | COc1ccc(-n2c(SCC(=O)NC3CCCc4ccccc43)nnc2-c2ccccc2OC)cc1 |
| InChI | InChI=1S/C28H28N4O3S/c1-34-21-16-14-20(15-17-21)32-27(23-11-5-6-13-25(23)35-2)30-31-28(32)36-18-26(33)29-24-12-7-9-19-8-3-4-10-22(19)24/h3-6,8,10-11,13-17,24H,7,9,12,18H2,1-2H3,(H,29,33) |
| InChIKey | DLHZCDIVEVOANB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |