C19H17N3O7S — CID 4832939
[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate (PubChem CID 4832939) has the molecular formula C19H17N3O7S and a molecular weight of 431.43 g/mol. Its IUPAC name is [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate.
| Compound Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 4832939 |
| Molecular Formula | C19H17N3O7S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| SMILES | COc1cc(NC(=O)COC(=O)c2ccc3c(c2)NC(=O)CS3)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17N3O7S/c1-10-5-14(22(26)27)15(28-2)7-12(10)20-17(23)8-29-19(25)11-3-4-16-13(6-11)21-18(24)9-30-16/h3-7H,8-9H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | HNKJOUFPDPCRSS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|