C22H32N2O9S — CID 4833026
4-O-[2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-O,5-O-dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 4833026) has the molecular formula C22H32N2O9S and a molecular weight of 500.57 g/mol. Its IUPAC name is 4-O-[2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-O,5-O-dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 4-O-[2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-O,5-O-dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 4833026 |
| Molecular Formula | C22H32N2O9S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 4-O-[2-[butan-2-yl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-O,5-O-dimethyl 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | CCC(C)N(C(=O)COC(=O)C1C(C(=O)OC)=C(C)NC(C)=C1C(=O)OC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C22H32N2O9S/c1-7-12(2)24(15-8-9-34(29,30)11-15)16(25)10-33-22(28)19-17(20(26)31-5)13(3)23-14(4)18(19)21(27)32-6/h12,15,19,23H,7-11H2,1-6H3 |
| InChIKey | GQJZIJBXNKLPPC-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|