C12H14N6O2 — CID 4835584
4-hydroxy-1-(1-phenyltetrazol-5-yl)pyrrolidine-2-carboxamide (PubChem CID 4835584) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 4-hydroxy-1-(1-phenyltetrazol-5-yl)pyrrolidine-2-carboxamide.
| Compound Name | 4-hydroxy-1-(1-phenyltetrazol-5-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 4835584 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 4-hydroxy-1-(1-phenyltetrazol-5-yl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CC(O)CN1c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C12H14N6O2/c13-11(20)10-6-9(19)7-17(10)12-14-15-16-18(12)8-4-2-1-3-5-8/h1-5,9-10,19H,6-7H2,(H2,13,20) |
| InChIKey | JCMCWAFIILCUIK-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |