C34H40FNO6 — CID 4838040
3-[[3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one (PubChem CID 4838040) has the molecular formula C34H40FNO6 and a molecular weight of 577.69 g/mol. Its IUPAC name is 3-[[3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one.
| Compound Name | 3-[[3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 4838040 |
| Molecular Formula | C34H40FNO6 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | 3-[[3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidin-1-yl]methyl]-8a-methylspiro[3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-5,2'-oxirane]-2-one |
| SMILES | CC12CCCC3(CO3)C1CC1C(C2)OC(=O)C1CN1CCC(c2ccc(F)cc2)C(COc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C34H40FNO6/c1-33-10-2-11-34(19-41-34)31(33)14-26-27(32(37)42-30(26)15-33)17-36-12-9-25(21-3-5-23(35)6-4-21)22(16-36)18-38-24-7-8-28-29(13-24)40-20-39-28/h3-8,13,22,25-27,30-31H,2,9-12,14-20H2,1H3 |
| InChIKey | HOTAQAZRISGVGC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 69.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|