C21H18N4OS — CID 4838698
N-[[2-(1-methylbenzimidazol-2-yl)-1-phenylethylidene]amino]thiophene-2-carboxamide (PubChem CID 4838698) has the molecular formula C21H18N4OS and a molecular weight of 374.47 g/mol. Its IUPAC name is N-[[2-(1-methylbenzimidazol-2-yl)-1-phenylethylidene]amino]thiophene-2-carboxamide.
| Compound Name | N-[[2-(1-methylbenzimidazol-2-yl)-1-phenylethylidene]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4838698 |
| Molecular Formula | C21H18N4OS |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | N-[[2-(1-methylbenzimidazol-2-yl)-1-phenylethylidene]amino]thiophene-2-carboxamide |
| SMILES | Cn1c(CC(=NNC(=O)c2cccs2)c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C21H18N4OS/c1-25-18-11-6-5-10-16(18)22-20(25)14-17(15-8-3-2-4-9-15)23-24-21(26)19-12-7-13-27-19/h2-13H,14H2,1H3,(H,24,26) |
| InChIKey | ZQUDRXHJNWLRMT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|