C26H26ClN3O7S2 — CID 4839089
[2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl] 3-(benzylsulfamoyl)-4-chlorobenzoate (PubChem CID 4839089) has the molecular formula C26H26ClN3O7S2 and a molecular weight of 592.10 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl] 3-(benzylsulfamoyl)-4-chlorobenzoate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl] 3-(benzylsulfamoyl)-4-chlorobenzoate |
|---|---|
| PubChem CID | 4839089 |
| Molecular Formula | C26H26ClN3O7S2 |
| Molecular Weight | 592.10 g/mol |
| Exact Mass | 591.09 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl] 3-(benzylsulfamoyl)-4-chlorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c(S(=O)(=O)NCc2ccccc2)c1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C26H26ClN3O7S2/c27-23-13-8-20(16-24(23)38(33,34)28-17-19-6-2-1-3-7-19)26(32)37-18-25(31)29-21-9-11-22(12-10-21)39(35,36)30-14-4-5-15-30/h1-3,6-13,16,28H,4-5,14-15,17-18H2,(H,29,31) |
| InChIKey | MSAOODUZBNJQRS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.10 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |