C21H31NO2 — CID 4839099
5,8a-dimethyl-3-[(2-methylpiperidin-1-yl)methyl]-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one (PubChem CID 4839099) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 5,8a-dimethyl-3-[(2-methylpiperidin-1-yl)methyl]-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | 5,8a-dimethyl-3-[(2-methylpiperidin-1-yl)methyl]-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 4839099 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 5,8a-dimethyl-3-[(2-methylpiperidin-1-yl)methyl]-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CC1=CCCC2(C)CC3OC(=O)C(CN4CCCCC4C)C3C=C12 |
| InChI | InChI=1S/C21H31NO2/c1-14-7-6-9-21(3)12-19-16(11-18(14)21)17(20(23)24-19)13-22-10-5-4-8-15(22)2/h7,11,15-17,19H,4-6,8-10,12-13H2,1-3H3 |
| InChIKey | KSGDACOCXABHHQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |