C26H32ClNO3 — CID 4837615
3-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-5,8a-dimethyl-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one (PubChem CID 4837615) has the molecular formula C26H32ClNO3 and a molecular weight of 442.00 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-5,8a-dimethyl-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | 3-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-5,8a-dimethyl-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 4837615 |
| Molecular Formula | C26H32ClNO3 |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 3-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-5,8a-dimethyl-3,3a,7,8,9,9a-hexahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CC1=CCCC2(C)CC3OC(=O)C(CN4CCC(O)(c5ccc(Cl)cc5)CC4)C3C=C12 |
| InChI | InChI=1S/C26H32ClNO3/c1-17-4-3-9-25(2)15-23-20(14-22(17)25)21(24(29)31-23)16-28-12-10-26(30,11-13-28)18-5-7-19(27)8-6-18/h4-8,14,20-21,23,30H,3,9-13,15-16H2,1-2H3 |
| InChIKey | IQLFGAYBCMLNJE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |