C32H39ClN2O2 — CID 162871245
(3S,3aS,5R,8aS,9aR)-3-[[4-[(S)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 162871245) has the molecular formula C32H39ClN2O2 and a molecular weight of 519.13 g/mol. Its IUPAC name is (3S,3aS,5R,8aS,9aR)-3-[[4-[(S)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aS,5R,8aS,9aR)-3-[[4-[(S)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 162871245 |
| Molecular Formula | C32H39ClN2O2 |
| Molecular Weight | 519.13 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | (3S,3aS,5R,8aS,9aR)-3-[[4-[(S)-(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | C[C@@H]1CCC[C@@]2(C)C[C@H]3OC(=O)[C@H](CN4CCN([C@@H](c5ccccc5)c5ccc(Cl)cc5)CC4)[C@@H]3C=C12 |
| InChI | InChI=1S/C32H39ClN2O2/c1-22-7-6-14-32(2)20-29-26(19-28(22)32)27(31(36)37-29)21-34-15-17-35(18-16-34)30(23-8-4-3-5-9-23)24-10-12-25(33)13-11-24/h3-5,8-13,19,22,26-27,29-30H,6-7,14-18,20-21H2,1-2H3/t22-,26+,27-,29-,30+,32+/m1/s1 |
| InChIKey | GCGDEQDQFMMORL-MZTWROOUSA-N |
| XLogP | 6.36 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.13 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|