C22H23Cl2N3S — CID 4839924
3-(4-tert-butylphenyl)-5-[(2,2-dichlorocyclopropyl)methylsulfanyl]-4-phenyl-1,2,4-triazole (PubChem CID 4839924) has the molecular formula C22H23Cl2N3S and a molecular weight of 432.42 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-5-[(2,2-dichlorocyclopropyl)methylsulfanyl]-4-phenyl-1,2,4-triazole.
| Compound Name | 3-(4-tert-butylphenyl)-5-[(2,2-dichlorocyclopropyl)methylsulfanyl]-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 4839924 |
| Molecular Formula | C22H23Cl2N3S |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 3-(4-tert-butylphenyl)-5-[(2,2-dichlorocyclopropyl)methylsulfanyl]-4-phenyl-1,2,4-triazole |
| SMILES | CC(C)(C)c1ccc(-c2nnc(SCC3CC3(Cl)Cl)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23Cl2N3S/c1-21(2,3)16-11-9-15(10-12-16)19-25-26-20(28-14-17-13-22(17,23)24)27(19)18-7-5-4-6-8-18/h4-12,17H,13-14H2,1-3H3 |
| InChIKey | LZKZODGLOMQBGY-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|