C27H27N3O3S — CID 4840728
(4-phenylmethoxyphenyl) 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-4-carboxylate (PubChem CID 4840728) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is (4-phenylmethoxyphenyl) 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-4-carboxylate.
| Compound Name | (4-phenylmethoxyphenyl) 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4840728 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (4-phenylmethoxyphenyl) 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperidine-4-carboxylate |
| SMILES | Cc1sc2ncnc(N3CCC(C(=O)Oc4ccc(OCc5ccccc5)cc4)CC3)c2c1C |
| InChI | InChI=1S/C27H27N3O3S/c1-18-19(2)34-26-24(18)25(28-17-29-26)30-14-12-21(13-15-30)27(31)33-23-10-8-22(9-11-23)32-16-20-6-4-3-5-7-20/h3-11,17,21H,12-16H2,1-2H3 |
| InChIKey | WVORDHOXORXNJT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|