C23H27N5O4S — CID 25162448
1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N'-[2-(4-methoxyphenoxy)acetyl]piperidine-4-carbohydrazide (PubChem CID 25162448) has the molecular formula C23H27N5O4S and a molecular weight of 469.57 g/mol. Its IUPAC name is 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N'-[2-(4-methoxyphenoxy)acetyl]piperidine-4-carbohydrazide.
| Compound Name | 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N'-[2-(4-methoxyphenoxy)acetyl]piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 25162448 |
| Molecular Formula | C23H27N5O4S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N'-[2-(4-methoxyphenoxy)acetyl]piperidine-4-carbohydrazide |
| SMILES | COc1ccc(OCC(=O)NNC(=O)C2CCN(c3ncnc4sc(C)c(C)c34)CC2)cc1 |
| InChI | InChI=1S/C23H27N5O4S/c1-14-15(2)33-23-20(14)21(24-13-25-23)28-10-8-16(9-11-28)22(30)27-26-19(29)12-32-18-6-4-17(31-3)5-7-18/h4-7,13,16H,8-12H2,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | JBVZLGSHGPLQBO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|