C19H22N6O2S — CID 78813402
1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N'-(1H-pyrrole-2-carbonyl)piperidine-4-carbohydrazide (PubChem CID 78813402) has the molecular formula C19H22N6O2S and a molecular weight of 398.49 g/mol. Its IUPAC name is 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N'-(1H-pyrrole-2-carbonyl)piperidine-4-carbohydrazide.
| Compound Name | 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N'-(1H-pyrrole-2-carbonyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 78813402 |
| Molecular Formula | C19H22N6O2S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N'-(1H-pyrrole-2-carbonyl)piperidine-4-carbohydrazide |
| SMILES | Cc1sc2ncnc(N3CCC(C(=O)NNC(=O)c4ccc[nH]4)CC3)c2c1C |
| InChI | InChI=1S/C19H22N6O2S/c1-11-12(2)28-19-15(11)16(21-10-22-19)25-8-5-13(6-9-25)17(26)23-24-18(27)14-4-3-7-20-14/h3-4,7,10,13,20H,5-6,8-9H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | RDHCRXPWWSFYLQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|