C21H22FN5O2S — CID 30275952
1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N'-(2-fluorobenzoyl)piperidine-4-carbohydrazide (PubChem CID 30275952) has the molecular formula C21H22FN5O2S and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N'-(2-fluorobenzoyl)piperidine-4-carbohydrazide.
| Compound Name | 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N'-(2-fluorobenzoyl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 30275952 |
| Molecular Formula | C21H22FN5O2S |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 1-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N'-(2-fluorobenzoyl)piperidine-4-carbohydrazide |
| SMILES | Cc1sc2ncnc(N3CCC(C(=O)NNC(=O)c4ccccc4F)CC3)c2c1C |
| InChI | InChI=1S/C21H22FN5O2S/c1-12-13(2)30-21-17(12)18(23-11-24-21)27-9-7-14(8-10-27)19(28)25-26-20(29)15-5-3-4-6-16(15)22/h3-6,11,14H,7-10H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | VYOHJBKZAFVLES-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|