C25H19ClN2O3S — CID 4842003
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 4842003) has the molecular formula C25H19ClN2O3S and a molecular weight of 462.96 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 4842003 |
| Molecular Formula | C25H19ClN2O3S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2C=CC(=O)OCC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C25H19ClN2O3S/c1-17-7-9-18(10-8-17)25-19(15-28(27-25)20-5-3-2-4-6-20)11-14-24(30)31-16-21(29)22-12-13-23(26)32-22/h2-15H,16H2,1H3 |
| InChIKey | GXLPJDLAQXKYLK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|