C18H12Cl4N2O3 — CID 4843029
N-(4-ethylphenyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 4843029) has the molecular formula C18H12Cl4N2O3 and a molecular weight of 446.12 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(4-ethylphenyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 4843029 |
| Molecular Formula | C18H12Cl4N2O3 |
| Molecular Weight | 446.12 g/mol |
| Exact Mass | 443.96 |
| IUPAC Name | N-(4-ethylphenyl)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | CCc1ccc(NC(=O)CN2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)cc1 |
| InChI | InChI=1S/C18H12Cl4N2O3/c1-2-8-3-5-9(6-4-8)23-10(25)7-24-17(26)11-12(18(24)27)14(20)16(22)15(21)13(11)19/h3-6H,2,7H2,1H3,(H,23,25) |
| InChIKey | YIXPQFOPCLBCLE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.12 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|