C18H19N3O9S2 — CID 4843731
[2-(2-methoxy-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-nitrothiophene-2-carboxylate (PubChem CID 4843731) has the molecular formula C18H19N3O9S2 and a molecular weight of 485.50 g/mol. Its IUPAC name is [2-(2-methoxy-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-nitrothiophene-2-carboxylate.
| Compound Name | [2-(2-methoxy-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-nitrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4843731 |
| Molecular Formula | C18H19N3O9S2 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | [2-(2-methoxy-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-nitrothiophene-2-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)COC(=O)c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C18H19N3O9S2/c1-28-14-3-2-12(32(26,27)20-6-8-29-9-7-20)10-13(14)19-16(22)11-30-18(23)15-4-5-17(31-15)21(24)25/h2-5,10H,6-9,11H2,1H3,(H,19,22) |
| InChIKey | GAXLLTGQLIGRRV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|