C18H21N3O6S2 — CID 4850527
N-[2-(2-methoxy-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 4850527) has the molecular formula C18H21N3O6S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[2-(2-methoxy-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(2-methoxy-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4850527 |
| Molecular Formula | C18H21N3O6S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-[2-(2-methoxy-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)CNC(=O)c1cccs1 |
| InChI | InChI=1S/C18H21N3O6S2/c1-26-15-5-4-13(29(24,25)21-6-8-27-9-7-21)11-14(15)20-17(22)12-19-18(23)16-3-2-10-28-16/h2-5,10-11H,6-9,12H2,1H3,(H,19,23)(H,20,22) |
| InChIKey | XLCQUELECGFHQC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |