C29H23N3O3 — CID 4846608
3-[3-[[2-(4-ethoxyphenyl)-1,3-dioxoisoquinolin-4-ylidene]methyl]indol-1-yl]propanenitrile (PubChem CID 4846608) has the molecular formula C29H23N3O3 and a molecular weight of 461.52 g/mol. Its IUPAC name is 3-[3-[[2-(4-ethoxyphenyl)-1,3-dioxoisoquinolin-4-ylidene]methyl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[[2-(4-ethoxyphenyl)-1,3-dioxoisoquinolin-4-ylidene]methyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 4846608 |
| Molecular Formula | C29H23N3O3 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 3-[3-[[2-(4-ethoxyphenyl)-1,3-dioxoisoquinolin-4-ylidene]methyl]indol-1-yl]propanenitrile |
| SMILES | CCOc1ccc(N2C(=O)C(=Cc3cn(CCC#N)c4ccccc34)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C29H23N3O3/c1-2-35-22-14-12-21(13-15-22)32-28(33)25-10-4-3-9-24(25)26(29(32)34)18-20-19-31(17-7-16-30)27-11-6-5-8-23(20)27/h3-6,8-15,18-19H,2,7,17H2,1H3 |
| InChIKey | NLEBLSJGPBLILL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 75.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|