C28H21N3O2 — CID 29357489
3-[3-[(Z)-[2-(2-methylphenyl)-1,3-dioxoisoquinolin-4-ylidene]methyl]indol-1-yl]propanenitrile (PubChem CID 29357489) has the molecular formula C28H21N3O2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 3-[3-[(Z)-[2-(2-methylphenyl)-1,3-dioxoisoquinolin-4-ylidene]methyl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[(Z)-[2-(2-methylphenyl)-1,3-dioxoisoquinolin-4-ylidene]methyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 29357489 |
| Molecular Formula | C28H21N3O2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 3-[3-[(Z)-[2-(2-methylphenyl)-1,3-dioxoisoquinolin-4-ylidene]methyl]indol-1-yl]propanenitrile |
| SMILES | Cc1ccccc1N1C(=O)/C(=C\c2cn(CCC#N)c3ccccc23)c2ccccc2C1=O |
| InChI | InChI=1S/C28H21N3O2/c1-19-9-2-6-13-25(19)31-27(32)23-12-4-3-11-22(23)24(28(31)33)17-20-18-30(16-8-15-29)26-14-7-5-10-21(20)26/h2-7,9-14,17-18H,8,16H2,1H3/b24-17- |
| InChIKey | JXYODZCLXSEXOS-ULJHMMPZSA-N |
| XLogP | 5.59 |
| TPSA | 66.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|