C20H17N3O5S2 — CID 4846824
dimethyl 5-[[2-[(4-sulfanylidene-1H-quinazolin-2-yl)sulfanyl]acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 4846824) has the molecular formula C20H17N3O5S2 and a molecular weight of 443.51 g/mol. Its IUPAC name is dimethyl 5-[[2-[(4-sulfanylidene-1H-quinazolin-2-yl)sulfanyl]acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[(4-sulfanylidene-1H-quinazolin-2-yl)sulfanyl]acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 4846824 |
| Molecular Formula | C20H17N3O5S2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | dimethyl 5-[[2-[(4-sulfanylidene-1H-quinazolin-2-yl)sulfanyl]acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)CSc2nc(=S)c3ccccc3[nH]2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H17N3O5S2/c1-27-18(25)11-7-12(19(26)28-2)9-13(8-11)21-16(24)10-30-20-22-15-6-4-3-5-14(15)17(29)23-20/h3-9H,10H2,1-2H3,(H,21,24)(H,22,23,29) |
| InChIKey | GOXYPEVMYJIGBF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|