C24H27N5O6 — CID 4848331
N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-[(2,4-dimethoxyphenyl)methylideneamino]oxy-N-ethylacetamide (PubChem CID 4848331) has the molecular formula C24H27N5O6 and a molecular weight of 481.51 g/mol. Its IUPAC name is N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-[(2,4-dimethoxyphenyl)methylideneamino]oxy-N-ethylacetamide.
| Compound Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-[(2,4-dimethoxyphenyl)methylideneamino]oxy-N-ethylacetamide |
|---|---|
| PubChem CID | 4848331 |
| Molecular Formula | C24H27N5O6 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-2-[(2,4-dimethoxyphenyl)methylideneamino]oxy-N-ethylacetamide |
| SMILES | CCN(C(=O)CON=Cc1ccc(OC)cc1OC)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H27N5O6/c1-4-28(20(30)15-35-26-13-17-10-11-18(33-2)12-19(17)34-3)21-22(25)29(24(32)27-23(21)31)14-16-8-6-5-7-9-16/h5-13H,4,14-15,25H2,1-3H3,(H,27,31,32) |
| InChIKey | VZXGLUNPCXMDDW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 141.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|