C24H27N3O3S — CID 4848816
N-(2,5-dimethylphenyl)-2-phenyl-2-[2-(4-sulfamoylphenyl)ethylamino]acetamide (PubChem CID 4848816) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-phenyl-2-[2-(4-sulfamoylphenyl)ethylamino]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-phenyl-2-[2-(4-sulfamoylphenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 4848816 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-phenyl-2-[2-(4-sulfamoylphenyl)ethylamino]acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(NCCc2ccc(S(N)(=O)=O)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H27N3O3S/c1-17-8-9-18(2)22(16-17)27-24(28)23(20-6-4-3-5-7-20)26-15-14-19-10-12-21(13-11-19)31(25,29)30/h3-13,16,23,26H,14-15H2,1-2H3,(H,27,28)(H2,25,29,30) |
| InChIKey | CVHYYMDVLSOVBY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |