C20H23N3O6S2 — CID 4851594
2-[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]sulfanyl-4-oxo-3-prop-2-enylquinazoline-7-carboxylic acid (PubChem CID 4851594) has the molecular formula C20H23N3O6S2 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]sulfanyl-4-oxo-3-prop-2-enylquinazoline-7-carboxylic acid.
| Compound Name | 2-[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]sulfanyl-4-oxo-3-prop-2-enylquinazoline-7-carboxylic acid |
|---|---|
| PubChem CID | 4851594 |
| Molecular Formula | C20H23N3O6S2 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 2-[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]sulfanyl-4-oxo-3-prop-2-enylquinazoline-7-carboxylic acid |
| SMILES | C=CCn1c(SCC(=O)N(CC)C2CCS(=O)(=O)C2)nc2cc(C(=O)O)ccc2c1=O |
| InChI | InChI=1S/C20H23N3O6S2/c1-3-8-23-18(25)15-6-5-13(19(26)27)10-16(15)21-20(23)30-11-17(24)22(4-2)14-7-9-31(28,29)12-14/h3,5-6,10,14H,1,4,7-9,11-12H2,2H3,(H,26,27) |
| InChIKey | QSNYWJTVXVZPNJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|