C22H31N5O4S2 — CID 4851654
2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]acetamide (PubChem CID 4851654) has the molecular formula C22H31N5O4S2 and a molecular weight of 493.66 g/mol. Its IUPAC name is 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]acetamide.
| Compound Name | 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 4851654 |
| Molecular Formula | C22H31N5O4S2 |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2OC)nnc1C1CCCCC1 |
| InChI | InChI=1S/C22H31N5O4S2/c1-5-13-27-21(16-9-7-6-8-10-16)24-25-22(27)32-15-20(28)23-18-14-17(11-12-19(18)31-4)33(29,30)26(2)3/h5,11-12,14,16H,1,6-10,13,15H2,2-4H3,(H,23,28) |
| InChIKey | JRWJQMMHYSHFBM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|