C22H26N2O6 — CID 48523603
4-ethoxy-N-[(3-methoxyphenyl)methyl]-3-nitro-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 48523603) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is 4-ethoxy-N-[(3-methoxyphenyl)methyl]-3-nitro-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-ethoxy-N-[(3-methoxyphenyl)methyl]-3-nitro-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 48523603 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 4-ethoxy-N-[(3-methoxyphenyl)methyl]-3-nitro-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CCOc1ccc(C(=O)N(Cc2cccc(OC)c2)CC2CCCO2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26N2O6/c1-3-29-21-10-9-17(13-20(21)24(26)27)22(25)23(15-19-8-5-11-30-19)14-16-6-4-7-18(12-16)28-2/h4,6-7,9-10,12-13,19H,3,5,8,11,14-15H2,1-2H3 |
| InChIKey | FLQVKARTRUNZHB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|