C16H14ClF3N2OS — CID 4856563
2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(2-methylphenyl)propanamide (PubChem CID 4856563) has the molecular formula C16H14ClF3N2OS and a molecular weight of 374.82 g/mol. Its IUPAC name is 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(2-methylphenyl)propanamide.
| Compound Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 4856563 |
| Molecular Formula | C16H14ClF3N2OS |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-N-(2-methylphenyl)propanamide |
| SMILES | Cc1ccccc1NC(=O)C(C)Sc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C16H14ClF3N2OS/c1-9-5-3-4-6-13(9)22-14(23)10(2)24-15-12(17)7-11(8-21-15)16(18,19)20/h3-8,10H,1-2H3,(H,22,23) |
| InChIKey | RPEKCDJODJWRJV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |