C23H22BrN5O7S2 — CID 4857746
N-[4-[[2-[2-[4-[(4-bromophenyl)sulfonylamino]benzoyl]hydrazinyl]-2-oxoethyl]sulfamoyl]phenyl]acetamide (PubChem CID 4857746) has the molecular formula C23H22BrN5O7S2 and a molecular weight of 624.50 g/mol. Its IUPAC name is N-[4-[[2-[2-[4-[(4-bromophenyl)sulfonylamino]benzoyl]hydrazinyl]-2-oxoethyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[2-[2-[4-[(4-bromophenyl)sulfonylamino]benzoyl]hydrazinyl]-2-oxoethyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 4857746 |
| Molecular Formula | C23H22BrN5O7S2 |
| Molecular Weight | 624.50 g/mol |
| Exact Mass | 623.01 |
| IUPAC Name | N-[4-[[2-[2-[4-[(4-bromophenyl)sulfonylamino]benzoyl]hydrazinyl]-2-oxoethyl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCC(=O)NNC(=O)c2ccc(NS(=O)(=O)c3ccc(Br)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H22BrN5O7S2/c1-15(30)26-18-8-12-20(13-9-18)37(33,34)25-14-22(31)27-28-23(32)16-2-6-19(7-3-16)29-38(35,36)21-10-4-17(24)5-11-21/h2-13,25,29H,14H2,1H3,(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | RHAAVUPFVLYKNY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 179.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|