C23H29NO4 — CID 4857905
benzyl 1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 4857905) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is benzyl 1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | benzyl 1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 4857905 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | benzyl 1-(adamantane-1-carbonyl)-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1CC(O)CN1C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H29NO4/c25-19-9-20(21(26)28-14-15-4-2-1-3-5-15)24(13-19)22(27)23-10-16-6-17(11-23)8-18(7-16)12-23/h1-5,16-20,25H,6-14H2 |
| InChIKey | KBUDHXSBEIVQQM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |