C17H14Cl2N2O2S — CID 4857980
N-[2-(2,4-dichlorophenyl)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 4857980) has the molecular formula C17H14Cl2N2O2S and a molecular weight of 381.28 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 4857980 |
| Molecular Formula | C17H14Cl2N2O2S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | O=C1CSc2ccc(C(=O)NCCc3ccc(Cl)cc3Cl)cc2N1 |
| InChI | InChI=1S/C17H14Cl2N2O2S/c18-12-3-1-10(13(19)8-12)5-6-20-17(23)11-2-4-15-14(7-11)21-16(22)9-24-15/h1-4,7-8H,5-6,9H2,(H,20,23)(H,21,22) |
| InChIKey | UFNXBLAFONDNCZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |