C18H25N3O5S — CID 48583777
N-[[2-(tert-butylsulfamoyl)phenyl]methyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide (PubChem CID 48583777) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is N-[[2-(tert-butylsulfamoyl)phenyl]methyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide.
| Compound Name | N-[[2-(tert-butylsulfamoyl)phenyl]methyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 48583777 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-[[2-(tert-butylsulfamoyl)phenyl]methyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccccc1CNC(=O)CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C18H25N3O5S/c1-18(2,3)20-27(25,26)14-7-5-4-6-13(14)12-19-15(22)10-11-21-16(23)8-9-17(21)24/h4-7,20H,8-12H2,1-3H3,(H,19,22) |
| InChIKey | DHLLGBFQYATLGJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|